## Chemical Structure and Identifier ### Overview The image shows a chemical structure diagram and its corresponding InChI identifier. The diagram depicts a molecule, and an arrow points from the diagram to the InChI string. ### Components/Axes * **Chemical Structure Diagram:** A 2D representation of a molecule, showing atoms and bonds. * **Arrow:** A gray arrow pointing from the chemical structure to the InChI identifier. * **InChI Identifier:** A text string representing the chemical structure. ### Detailed Analysis or ### Content Details * **Chemical Structure:** The molecule appears to be a substituted benzene ring. It includes an isopropyl group attached to a sulfur atom, another isopropyl group directly attached to the ring, and a hydroxyl group (OH) also attached to the ring. * **InChI Identifier:** The InChI string is: `InChI=1/C12H18OS/c1-8(2)14-12-6-5-9(3)7-11(12)10(4)13/h5-8,10,13H,1-4H3` ### Key Observations * The arrow visually connects the chemical structure with its InChI identifier. * The InChI string is a compact, machine-readable representation of the chemical structure. ### Interpretation The image provides a visual and textual representation of a chemical compound. The chemical structure diagram allows for easy visualization of the molecule, while the InChI identifier provides a standardized way to represent and search for the compound in databases and other digital resources. The InChI string is derived from the structure and encodes information about the connectivity and stereochemistry of the molecule.