## Chemical Diagram with InChI Identifier
### Overview
The image displays a two-part technical representation of a chemical compound. On the left is a skeletal structure diagram of an organic molecule. On the right, connected by a right-pointing arrow, is the corresponding International Chemical Identifier (InChI) string for that molecule. The overall purpose is to provide both a visual and a standardized textual representation of the same chemical entity.
### Components/Axes
1. **Left Component (Chemical Structure Diagram):**
* A 2D skeletal formula.
* Contains a benzene ring (hexagon with alternating double bonds implied).
* Substituents on the ring: a methyl group (`-CH3`) at the top position, and a longer side chain at the bottom-left position.
* The side chain consists of: a sulfur atom (`S`) bonded to the ring, connected to a carbon chain that includes a hydroxyl group (`-OH`) and terminates in an isopropyl group (a carbon bonded to two methyl groups).
* All atoms and bonds are drawn in black lines on a white background, enclosed in a thin black border.
2. **Right Component (InChI String):**
* A block of text containing the InChI string.
* The text is left-aligned and spans multiple lines.
* **Exact Transcription:**
```
InChI=1/C12H18OS/c1-8(2)14-12
-6-5-9(3)7-11(12)10(4)13/h5-8
,10,13H,1-4H3
```
3. **Connecting Element:**
* A solid, right-pointing gray arrow (`→`) is positioned between the diagram and the text, indicating the transformation or mapping from the visual structure to the identifier.
### Detailed Analysis
* **Chemical Structure Breakdown:**
* **Core:** A benzene ring (C6H4, as two positions are substituted).
* **Substituent 1 (Top):** A methyl group (`-CH3`).
* **Substituent 2 (Bottom-Left):** A complex side chain. The connectivity is: Ring Carbon -> Sulfur (`S`) -> CH2 -> CH(OH) -> CH(CH3)2. This corresponds to a 2-(isopropylthio)ethanol derivative attached to the ring.
* The molecular formula, as indicated by the InChI, is C₁₂H₁₈OS.
* **InChI String Layer Breakdown:**
* `InChI=1/`: Standard InChI version 1.
* `C12H18OS/`: Molecular formula layer. Confirms 12 Carbon, 18 Hydrogen, 1 Oxygen, 1 Sulfur.
* `c1-8(2)14-12-6-5-9(3)7-11(12)10(4)13`: Connectivity layer. This is a canonical numbering of atoms describing the bonding skeleton. It encodes the structure shown in the diagram.
* `h5-8,10,13`: Hydrogen layer. Indicates the locations of hydrogen atoms attached to the heavy atoms numbered 5, 6, 7, 8, 10, and 13 in the canonical numbering.
* `,1-4H3`: Mobile hydrogen layer. Indicates that hydrogens on atoms 1, 2, 3, and 4 (likely the methyl groups) are equivalent and can tautomerize.
### Key Observations
1. The image is a direct mapping: the InChI string on the right is the unique, machine-readable identifier for the exact chemical structure drawn on the left.
2. The InChI string is broken across three lines for display, but it represents a single continuous identifier. The line breaks do not have chemical meaning.
3. The diagram uses standard organic chemistry notation (skeletal formula), where carbon atoms are at vertices and ends of lines, and hydrogen atoms attached to carbons are implied.
### Interpretation
This image serves as a technical reference or educational tool. It demonstrates the relationship between a human-readable chemical structure diagram and a computer-friendly chemical identifier.
* **Purpose:** The InChI string allows for unambiguous database searching, indexing, and information retrieval for this specific compound. The diagram provides immediate visual comprehension for a chemist.
* **Relationship:** The arrow explicitly links the two representations, showing that the InChI is derived from the structure. The InChI's connectivity (`c`) and hydrogen (`h`) layers are a direct numerical translation of the bonds and atoms shown in the diagram.
* **Notable Detail:** The inclusion of the mobile hydrogen layer (`,1-4H3`) in the InChI suggests the compound may have tautomeric forms or that the hydrogens on the methyl groups are considered equivalent for identification purposes, which is a specific nuance captured by the identifier that is not explicitly visualized in the static diagram.
**Language Declaration:** The text in the image is technical notation (chemical symbols and InChI standard). No natural language is present.